C14H21NO2S — CID 3120116
2-[(3,5-dimethylphenyl)methylsulfanyl]-N-(2-methoxyethyl)acetamide (PubChem CID 3120116) has the molecular formula C14H21NO2S and a molecular weight of 267.39 g/mol. Its IUPAC name is 2-[(3,5-dimethylphenyl)methylsulfanyl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[(3,5-dimethylphenyl)methylsulfanyl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 3120116 |
| Molecular Formula | C14H21NO2S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 2-[(3,5-dimethylphenyl)methylsulfanyl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CSCc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C14H21NO2S/c1-11-6-12(2)8-13(7-11)9-18-10-14(16)15-4-5-17-3/h6-8H,4-5,9-10H2,1-3H3,(H,15,16) |
| InChIKey | MRNYSEZQBNKXOL-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|