About 2-methyl-N'-(2-oxo-2-piperidin-1-ylacetyl)benzohydrazide
2-methyl-N'-(2-oxo-2-piperidin-1-ylacetyl)benzohydrazide (PubChem CID 3120164) has the molecular formula C15H19N3O3
and a molecular weight of 289.33 g/mol. Its IUPAC name is 2-methyl-N'-(2-oxo-2-piperidin-1-ylacetyl)benzohydrazide.
Molecular Properties
| Compound Name | 2-methyl-N'-(2-oxo-2-piperidin-1-ylacetyl)benzohydrazide |
| PubChem CID | 3120164 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 2-methyl-N'-(2-oxo-2-piperidin-1-ylacetyl)benzohydrazide |
| SMILES | Cc1ccccc1C(=O)NNC(=O)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C15H19N3O3/c1-11-7-3-4-8-12(11)13(19)16-17-14(20)15(21)18-9-5-2-6-10-18/h3-4,7-8H,2,5-6,9-10H2,1H3,(H,16,19)(H,17,20) |
| InChIKey | WYCONFASRUBYCC-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-N'-(2-oxo-2-piperidin-1-ylacetyl)benzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N'-(2-oxo-2-piperidin-1-ylacetyl)benzohydrazide?
The IUPAC name of 2-methyl-N'-(2-oxo-2-piperidin-1-ylacetyl)benzohydrazide (CID 3120164) is 2-methyl-N'-(2-oxo-2-piperidin-1-ylacetyl)benzohydrazide.
What is the SMILES notation for 2-methyl-N'-(2-oxo-2-piperidin-1-ylacetyl)benzohydrazide?
The canonical SMILES for 2-methyl-N'-(2-oxo-2-piperidin-1-ylacetyl)benzohydrazide is Cc1ccccc1C(=O)NNC(=O)C(=O)N1CCCCC1.
What is the InChIKey of 2-methyl-N'-(2-oxo-2-piperidin-1-ylacetyl)benzohydrazide?
The InChIKey is WYCONFASRUBYCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3O3/c1-11-7-3-4-8-12(11)13(19)16-17-14(20)15(21)18-9-5-2-6-10-18/h3-4,7-8H,2,5-6,9-10H2,1H3,(H,16,19)(H,17,20).
What are the key properties of 2-methyl-N'-(2-oxo-2-piperidin-1-ylacetyl)benzohydrazide?
2-methyl-N'-(2-oxo-2-piperidin-1-ylacetyl)benzohydrazide has a molecular weight of 289.33 g/mol, XLogP of 0.77, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N'-(2-oxo-2-piperidin-1-ylacetyl)benzohydrazide is sourced from PubChem (CID 3120164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).