C18H15ClFN — CID 3120372
6-chloro-4-(4-fluorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 3120372) has the molecular formula C18H15ClFN and a molecular weight of 299.78 g/mol. Its IUPAC name is 6-chloro-4-(4-fluorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | 6-chloro-4-(4-fluorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 3120372 |
| Molecular Formula | C18H15ClFN |
| Molecular Weight | 299.78 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 6-chloro-4-(4-fluorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | Fc1ccc(C2Nc3c(Cl)cccc3C3C=CCC32)cc1 |
| InChI | InChI=1S/C18H15ClFN/c19-16-6-2-5-15-13-3-1-4-14(13)17(21-18(15)16)11-7-9-12(20)10-8-11/h1-3,5-10,13-14,17,21H,4H2 |
| InChIKey | DQHRCIFCYYPLIS-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.78 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|