C23H14N6O8 — CID 3120391
2-[3,5-dimethyl-1-(4-nitrophenyl)pyrazol-4-yl]-5,8-dinitrobenzo[de]isoquinoline-1,3-dione (PubChem CID 3120391) has the molecular formula C23H14N6O8 and a molecular weight of 502.40 g/mol. Its IUPAC name is 2-[3,5-dimethyl-1-(4-nitrophenyl)pyrazol-4-yl]-5,8-dinitrobenzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[3,5-dimethyl-1-(4-nitrophenyl)pyrazol-4-yl]-5,8-dinitrobenzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 3120391 |
| Molecular Formula | C23H14N6O8 |
| Molecular Weight | 502.40 g/mol |
| Exact Mass | 502.09 |
| IUPAC Name | 2-[3,5-dimethyl-1-(4-nitrophenyl)pyrazol-4-yl]-5,8-dinitrobenzo[de]isoquinoline-1,3-dione |
| SMILES | Cc1nn(-c2ccc([N+](=O)[O-])cc2)c(C)c1N1C(=O)c2cc([N+](=O)[O-])cc3cc([N+](=O)[O-])cc(c23)C1=O |
| InChI | InChI=1S/C23H14N6O8/c1-11-21(12(2)26(24-11)14-3-5-15(6-4-14)27(32)33)25-22(30)18-9-16(28(34)35)7-13-8-17(29(36)37)10-19(20(13)18)23(25)31/h3-10H,1-2H3 |
| InChIKey | HXIWTXOQYLDIPF-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 184.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.40 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|