About N-(3-morpholin-4-ylpropyl)-N'-(2-phenylethyl)oxamide
N-(3-morpholin-4-ylpropyl)-N'-(2-phenylethyl)oxamide (PubChem CID 3120489) has the molecular formula C17H25N3O3
and a molecular weight of 319.40 g/mol. Its IUPAC name is N-(3-morpholin-4-ylpropyl)-N'-(2-phenylethyl)oxamide.
Molecular Properties
| Compound Name | N-(3-morpholin-4-ylpropyl)-N'-(2-phenylethyl)oxamide |
| PubChem CID | 3120489 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | N-(3-morpholin-4-ylpropyl)-N'-(2-phenylethyl)oxamide |
| SMILES | O=C(NCCCN1CCOCC1)C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C17H25N3O3/c21-16(18-8-4-10-20-11-13-23-14-12-20)17(22)19-9-7-15-5-2-1-3-6-15/h1-3,5-6H,4,7-14H2,(H,18,21)(H,19,22) |
| InChIKey | XEXNBQLZJZLRPK-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(3-morpholin-4-ylpropyl)-N'-(2-phenylethyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-morpholin-4-ylpropyl)-N'-(2-phenylethyl)oxamide?
The IUPAC name of N-(3-morpholin-4-ylpropyl)-N'-(2-phenylethyl)oxamide (CID 3120489) is N-(3-morpholin-4-ylpropyl)-N'-(2-phenylethyl)oxamide.
What is the SMILES notation for N-(3-morpholin-4-ylpropyl)-N'-(2-phenylethyl)oxamide?
The canonical SMILES for N-(3-morpholin-4-ylpropyl)-N'-(2-phenylethyl)oxamide is O=C(NCCCN1CCOCC1)C(=O)NCCc1ccccc1.
What is the InChIKey of N-(3-morpholin-4-ylpropyl)-N'-(2-phenylethyl)oxamide?
The InChIKey is XEXNBQLZJZLRPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25N3O3/c21-16(18-8-4-10-20-11-13-23-14-12-20)17(22)19-9-7-15-5-2-1-3-6-15/h1-3,5-6H,4,7-14H2,(H,18,21)(H,19,22).
What are the key properties of N-(3-morpholin-4-ylpropyl)-N'-(2-phenylethyl)oxamide?
N-(3-morpholin-4-ylpropyl)-N'-(2-phenylethyl)oxamide has a molecular weight of 319.40 g/mol, XLogP of 0.18, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-morpholin-4-ylpropyl)-N'-(2-phenylethyl)oxamide is sourced from PubChem (CID 3120489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).