About [4-benzamido-2-(1,3-benzothiazol-2-yl)phenyl] benzoate
[4-benzamido-2-(1,3-benzothiazol-2-yl)phenyl] benzoate (PubChem CID 3120640) has the molecular formula C27H18N2O3S
and a molecular weight of 450.52 g/mol. Its IUPAC name is [4-benzamido-2-(1,3-benzothiazol-2-yl)phenyl] benzoate.
Molecular Properties
| Compound Name | [4-benzamido-2-(1,3-benzothiazol-2-yl)phenyl] benzoate |
| PubChem CID | 3120640 |
| Molecular Formula | C27H18N2O3S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | [4-benzamido-2-(1,3-benzothiazol-2-yl)phenyl] benzoate |
| SMILES | O=C(Nc1ccc(OC(=O)c2ccccc2)c(-c2nc3ccccc3s2)c1)c1ccccc1 |
| InChI | InChI=1S/C27H18N2O3S/c30-25(18-9-3-1-4-10-18)28-20-15-16-23(32-27(31)19-11-5-2-6-12-19)21(17-20)26-29-22-13-7-8-14-24(22)33-26/h1-17H,(H,28,30) |
| InChIKey | VVDQEWYMZIZMDY-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-benzamido-2-(1,3-benzothiazol-2-yl)phenyl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-benzamido-2-(1,3-benzothiazol-2-yl)phenyl] benzoate?
The IUPAC name of [4-benzamido-2-(1,3-benzothiazol-2-yl)phenyl] benzoate (CID 3120640) is [4-benzamido-2-(1,3-benzothiazol-2-yl)phenyl] benzoate.
What is the SMILES notation for [4-benzamido-2-(1,3-benzothiazol-2-yl)phenyl] benzoate?
The canonical SMILES for [4-benzamido-2-(1,3-benzothiazol-2-yl)phenyl] benzoate is O=C(Nc1ccc(OC(=O)c2ccccc2)c(-c2nc3ccccc3s2)c1)c1ccccc1.
What is the InChIKey of [4-benzamido-2-(1,3-benzothiazol-2-yl)phenyl] benzoate?
The InChIKey is VVDQEWYMZIZMDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H18N2O3S/c30-25(18-9-3-1-4-10-18)28-20-15-16-23(32-27(31)19-11-5-2-6-12-19)21(17-20)26-29-22-13-7-8-14-24(22)33-26/h1-17H,(H,28,30).
What are the key properties of [4-benzamido-2-(1,3-benzothiazol-2-yl)phenyl] benzoate?
[4-benzamido-2-(1,3-benzothiazol-2-yl)phenyl] benzoate has a molecular weight of 450.52 g/mol, XLogP of 6.43, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-benzamido-2-(1,3-benzothiazol-2-yl)phenyl] benzoate is sourced from PubChem (CID 3120640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).