C36H32N2O12S3 — CID 3120696
tetramethyl 6'-[2-(1,3-dioxoisoindol-2-yl)propanoyl]-9'-methoxy-5',5'-dimethylspiro[1,3-dithiole-2,1'-thiopyrano[2,3-c]quinoline]-2',3',4,5-tetracarboxylate (PubChem CID 3120696) has the molecular formula C36H32N2O12S3 and a molecular weight of 780.85 g/mol. Its IUPAC name is tetramethyl 6'-[2-(1,3-dioxoisoindol-2-yl)propanoyl]-9'-methoxy-5',5'-dimethylspiro[1,3-dithiole-2,1'-thiopyrano[2,3-c]quinoline]-2',3',4,5-tetracarboxylate.
| Compound Name | tetramethyl 6'-[2-(1,3-dioxoisoindol-2-yl)propanoyl]-9'-methoxy-5',5'-dimethylspiro[1,3-dithiole-2,1'-thiopyrano[2,3-c]quinoline]-2',3',4,5-tetracarboxylate |
|---|---|
| PubChem CID | 3120696 |
| Molecular Formula | C36H32N2O12S3 |
| Molecular Weight | 780.85 g/mol |
| Exact Mass | 780.11 |
| IUPAC Name | tetramethyl 6'-[2-(1,3-dioxoisoindol-2-yl)propanoyl]-9'-methoxy-5',5'-dimethylspiro[1,3-dithiole-2,1'-thiopyrano[2,3-c]quinoline]-2',3',4,5-tetracarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC2(S1)C(C(=O)OC)=C(C(=O)OC)SC1=C2c2cc(OC)ccc2N(C(=O)C(C)N2C(=O)c3ccccc3C2=O)C1(C)C |
| InChI | InChI=1S/C36H32N2O12S3/c1-16(37-29(40)18-11-9-10-12-19(18)30(37)41)28(39)38-21-14-13-17(46-4)15-20(21)22-27(35(38,2)3)51-24(32(43)48-6)23(31(42)47-5)36(22)52-25(33(44)49-7)26(53-36)34(45)50-8/h9-16H,1-8H3 |
| InChIKey | FBBKCPRAVIQGGB-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 172.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.85 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|