C22H29BrN2O2 — CID 31215833
2-(1-adamantyl)-N-[2-[(2-bromophenyl)methyl-methylamino]-2-oxoethyl]acetamide (PubChem CID 31215833) has the molecular formula C22H29BrN2O2 and a molecular weight of 433.39 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-[2-[(2-bromophenyl)methyl-methylamino]-2-oxoethyl]acetamide.
| Compound Name | 2-(1-adamantyl)-N-[2-[(2-bromophenyl)methyl-methylamino]-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 31215833 |
| Molecular Formula | C22H29BrN2O2 |
| Molecular Weight | 433.39 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 2-(1-adamantyl)-N-[2-[(2-bromophenyl)methyl-methylamino]-2-oxoethyl]acetamide |
| SMILES | CN(Cc1ccccc1Br)C(=O)CNC(=O)CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H29BrN2O2/c1-25(14-18-4-2-3-5-19(18)23)21(27)13-24-20(26)12-22-9-15-6-16(10-22)8-17(7-15)11-22/h2-5,15-17H,6-14H2,1H3,(H,24,26) |
| InChIKey | QVYKURWVYPLIGV-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.39 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |