C24H23NO3 — CID 3121604
1-amino-6-(2,2-dimethyl-6-phenyl-1,3-dioxin-4-ylidene)-1-phenylhexa-1,4-dien-3-one (PubChem CID 3121604) has the molecular formula C24H23NO3 and a molecular weight of 373.45 g/mol. Its IUPAC name is 1-amino-6-(2,2-dimethyl-6-phenyl-1,3-dioxin-4-ylidene)-1-phenylhexa-1,4-dien-3-one.
| Compound Name | 1-amino-6-(2,2-dimethyl-6-phenyl-1,3-dioxin-4-ylidene)-1-phenylhexa-1,4-dien-3-one |
|---|---|
| PubChem CID | 3121604 |
| Molecular Formula | C24H23NO3 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 1-amino-6-(2,2-dimethyl-6-phenyl-1,3-dioxin-4-ylidene)-1-phenylhexa-1,4-dien-3-one |
| SMILES | CC1(C)OC(=CC=CC(=O)C=C(N)c2ccccc2)C=C(c2ccccc2)O1 |
| InChI | InChI=1S/C24H23NO3/c1-24(2)27-21(17-23(28-24)19-12-7-4-8-13-19)15-9-14-20(26)16-22(25)18-10-5-3-6-11-18/h3-17H,25H2,1-2H3 |
| InChIKey | JKTDDLQJKLQVLD-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|