C16H17N3O3S2 — CID 31223736
3-(2,5-dimethylfuran-3-yl)-5-thiophen-3-ylsulfonyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine (PubChem CID 31223736) has the molecular formula C16H17N3O3S2 and a molecular weight of 363.46 g/mol. Its IUPAC name is 3-(2,5-dimethylfuran-3-yl)-5-thiophen-3-ylsulfonyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine.
| Compound Name | 3-(2,5-dimethylfuran-3-yl)-5-thiophen-3-ylsulfonyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine |
|---|---|
| PubChem CID | 31223736 |
| Molecular Formula | C16H17N3O3S2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 3-(2,5-dimethylfuran-3-yl)-5-thiophen-3-ylsulfonyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine |
| SMILES | Cc1cc(-c2n[nH]c3c2CN(S(=O)(=O)c2ccsc2)CC3)c(C)o1 |
| InChI | InChI=1S/C16H17N3O3S2/c1-10-7-13(11(2)22-10)16-14-8-19(5-3-15(14)17-18-16)24(20,21)12-4-6-23-9-12/h4,6-7,9H,3,5,8H2,1-2H3,(H,17,18) |
| InChIKey | CNGZVYFQFUOECC-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |