C20H23N2O2+ — CID 3122374
1-(4-Methoxyphenyl)-2-(6-methyl-1-propylpyrrolo[1,2-a]pyrazin-2-ium-2-yl)ethanone (PubChem CID 3122374) has the molecular formula C20H23N2O2+ and a molecular weight of 323.40 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-2-(6-methyl-1-propylpyrrolo[1,2-a]pyrazin-2-ium-2-yl)ethanone.
| Compound Name | 1-(4-Methoxyphenyl)-2-(6-methyl-1-propylpyrrolo[1,2-a]pyrazin-2-ium-2-yl)ethanone |
|---|---|
| PubChem CID | 3122374 |
| Molecular Formula | C20H23N2O2+ |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | 1-(4-methoxyphenyl)-2-(6-methyl-1-propylpyrrolo[1,2-a]pyrazin-2-ium-2-yl)ethanone |
| SMILES | CCCC1=[N+](C=CN2C1=CC=C2C)CC(=O)C3=CC=C(C=C3)OC |
| InChI | InChI=1S/C20H23N2O2/c1-4-5-18-19-11-6-15(2)22(19)13-12-21(18)14-20(23)16-7-9-17(24-3)10-8-16/h6-13H,4-5,14H2,1-3H3/q+1 |
| InChIKey | CDXFZIKYBVZSKJ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 34.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | 420 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|