C21H19FN6 — CID 31224515
4-[1-(4-fluorophenyl)pyrazol-4-yl]-N-(3-pyridin-2-ylpropyl)pyrimidin-2-amine (PubChem CID 31224515) has the molecular formula C21H19FN6 and a molecular weight of 374.42 g/mol. Its IUPAC name is 4-[1-(4-fluorophenyl)pyrazol-4-yl]-N-(3-pyridin-2-ylpropyl)pyrimidin-2-amine.
| Compound Name | 4-[1-(4-fluorophenyl)pyrazol-4-yl]-N-(3-pyridin-2-ylpropyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 31224515 |
| Molecular Formula | C21H19FN6 |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 4-[1-(4-fluorophenyl)pyrazol-4-yl]-N-(3-pyridin-2-ylpropyl)pyrimidin-2-amine |
| SMILES | Fc1ccc(-n2cc(-c3ccnc(NCCCc4ccccn4)n3)cn2)cc1 |
| InChI | InChI=1S/C21H19FN6/c22-17-6-8-19(9-7-17)28-15-16(14-26-28)20-10-13-25-21(27-20)24-12-3-5-18-4-1-2-11-23-18/h1-2,4,6-11,13-15H,3,5,12H2,(H,24,25,27) |
| InChIKey | RRJLCKHFTOSAFB-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|