About 6-methyl-5-nitro-2-N,4-N-bis(3-nitrophenyl)pyrimidine-2,4-diamine
6-methyl-5-nitro-2-N,4-N-bis(3-nitrophenyl)pyrimidine-2,4-diamine (PubChem CID 3122463) has the molecular formula C17H13N7O6
and a molecular weight of 411.33 g/mol. Its IUPAC name is 6-methyl-5-nitro-2-N,4-N-bis(3-nitrophenyl)pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 6-methyl-5-nitro-2-N,4-N-bis(3-nitrophenyl)pyrimidine-2,4-diamine |
| PubChem CID | 3122463 |
| Molecular Formula | C17H13N7O6 |
| Molecular Weight | 411.33 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | 6-methyl-5-nitro-2-N,4-N-bis(3-nitrophenyl)pyrimidine-2,4-diamine |
| SMILES | Cc1nc(Nc2cccc([N+](=O)[O-])c2)nc(Nc2cccc([N+](=O)[O-])c2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H13N7O6/c1-10-15(24(29)30)16(19-11-4-2-6-13(8-11)22(25)26)21-17(18-10)20-12-5-3-7-14(9-12)23(27)28/h2-9H,1H3,(H2,18,19,20,21) |
| InChIKey | MROXKTQIONINEZ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 179.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.33 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-5-nitro-2-N,4-N-bis(3-nitrophenyl)pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-5-nitro-2-N,4-N-bis(3-nitrophenyl)pyrimidine-2,4-diamine?
The IUPAC name of 6-methyl-5-nitro-2-N,4-N-bis(3-nitrophenyl)pyrimidine-2,4-diamine (CID 3122463) is 6-methyl-5-nitro-2-N,4-N-bis(3-nitrophenyl)pyrimidine-2,4-diamine.
What is the SMILES notation for 6-methyl-5-nitro-2-N,4-N-bis(3-nitrophenyl)pyrimidine-2,4-diamine?
The canonical SMILES for 6-methyl-5-nitro-2-N,4-N-bis(3-nitrophenyl)pyrimidine-2,4-diamine is Cc1nc(Nc2cccc([N+](=O)[O-])c2)nc(Nc2cccc([N+](=O)[O-])c2)c1[N+](=O)[O-].
What is the InChIKey of 6-methyl-5-nitro-2-N,4-N-bis(3-nitrophenyl)pyrimidine-2,4-diamine?
The InChIKey is MROXKTQIONINEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13N7O6/c1-10-15(24(29)30)16(19-11-4-2-6-13(8-11)22(25)26)21-17(18-10)20-12-5-3-7-14(9-12)23(27)28/h2-9H,1H3,(H2,18,19,20,21).
What are the key properties of 6-methyl-5-nitro-2-N,4-N-bis(3-nitrophenyl)pyrimidine-2,4-diamine?
6-methyl-5-nitro-2-N,4-N-bis(3-nitrophenyl)pyrimidine-2,4-diamine has a molecular weight of 411.33 g/mol, XLogP of 4.00, 7 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-5-nitro-2-N,4-N-bis(3-nitrophenyl)pyrimidine-2,4-diamine is sourced from PubChem (CID 3122463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).