C18H26N4OS — CID 31225103
1-[3-(2,2-dimethylpropyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-2-(2,4-dimethyl-1,3-thiazol-5-yl)ethanone (PubChem CID 31225103) has the molecular formula C18H26N4OS and a molecular weight of 346.50 g/mol. Its IUPAC name is 1-[3-(2,2-dimethylpropyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-2-(2,4-dimethyl-1,3-thiazol-5-yl)ethanone.
| Compound Name | 1-[3-(2,2-dimethylpropyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-2-(2,4-dimethyl-1,3-thiazol-5-yl)ethanone |
|---|---|
| PubChem CID | 31225103 |
| Molecular Formula | C18H26N4OS |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 1-[3-(2,2-dimethylpropyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-2-(2,4-dimethyl-1,3-thiazol-5-yl)ethanone |
| SMILES | Cc1nc(C)c(CC(=O)N2CCc3[nH]nc(CC(C)(C)C)c3C2)s1 |
| InChI | InChI=1S/C18H26N4OS/c1-11-16(24-12(2)19-11)8-17(23)22-7-6-14-13(10-22)15(21-20-14)9-18(3,4)5/h6-10H2,1-5H3,(H,20,21) |
| InChIKey | VVWCBXOYNRSNCL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |