C18H19BrN2O5 — CID 3122653
prop-2-enyl 6-(6-bromo-1,3-benzodioxol-5-yl)-3-ethyl-4-methyl-2-oxo-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 3122653) has the molecular formula C18H19BrN2O5 and a molecular weight of 423.26 g/mol. Its IUPAC name is prop-2-enyl 6-(6-bromo-1,3-benzodioxol-5-yl)-3-ethyl-4-methyl-2-oxo-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | prop-2-enyl 6-(6-bromo-1,3-benzodioxol-5-yl)-3-ethyl-4-methyl-2-oxo-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 3122653 |
| Molecular Formula | C18H19BrN2O5 |
| Molecular Weight | 423.26 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | prop-2-enyl 6-(6-bromo-1,3-benzodioxol-5-yl)-3-ethyl-4-methyl-2-oxo-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | C=CCOC(=O)C1=C(C)N(CC)C(=O)NC1c1cc2c(cc1Br)OCO2 |
| InChI | InChI=1S/C18H19BrN2O5/c1-4-6-24-17(22)15-10(3)21(5-2)18(23)20-16(15)11-7-13-14(8-12(11)19)26-9-25-13/h4,7-8,16H,1,5-6,9H2,2-3H3,(H,20,23) |
| InChIKey | HQNQUETUMBNXSS-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.26 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|