About 4-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]anilino]-4-oxobutanoic acid
4-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]anilino]-4-oxobutanoic acid (PubChem CID 3122824) has the molecular formula C16H18N4O7S
and a molecular weight of 410.41 g/mol. Its IUPAC name is 4-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]anilino]-4-oxobutanoic acid.
Molecular Properties
| Compound Name | 4-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]anilino]-4-oxobutanoic acid |
| PubChem CID | 3122824 |
| Molecular Formula | C16H18N4O7S |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | 4-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]anilino]-4-oxobutanoic acid |
| SMILES | COc1cc(NS(=O)(=O)c2ccc(NC(=O)CCC(=O)O)cc2)nc(OC)n1 |
| InChI | InChI=1S/C16H18N4O7S/c1-26-14-9-12(18-16(19-14)27-2)20-28(24,25)11-5-3-10(4-6-11)17-13(21)7-8-15(22)23/h3-6,9H,7-8H2,1-2H3,(H,17,21)(H,22,23)(H,18,19,20) |
| InChIKey | VZBXLXMWJDBEBY-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 156.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 4-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]anilino]-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]anilino]-4-oxobutanoic acid?
The IUPAC name of 4-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]anilino]-4-oxobutanoic acid (CID 3122824) is 4-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]anilino]-4-oxobutanoic acid.
What is the SMILES notation for 4-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]anilino]-4-oxobutanoic acid?
The canonical SMILES for 4-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]anilino]-4-oxobutanoic acid is COc1cc(NS(=O)(=O)c2ccc(NC(=O)CCC(=O)O)cc2)nc(OC)n1.
What is the InChIKey of 4-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]anilino]-4-oxobutanoic acid?
The InChIKey is VZBXLXMWJDBEBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N4O7S/c1-26-14-9-12(18-16(19-14)27-2)20-28(24,25)11-5-3-10(4-6-11)17-13(21)7-8-15(22)23/h3-6,9H,7-8H2,1-2H3,(H,17,21)(H,22,23)(H,18,19,20).
What are the key properties of 4-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]anilino]-4-oxobutanoic acid?
4-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]anilino]-4-oxobutanoic acid has a molecular weight of 410.41 g/mol, XLogP of 1.10, 9 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]anilino]-4-oxobutanoic acid is sourced from PubChem (CID 3122824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).