About 3-(2-phenyl-1,3-thiazolidine-3-carbonyl)chromen-2-one
3-(2-phenyl-1,3-thiazolidine-3-carbonyl)chromen-2-one (PubChem CID 3123269) has the molecular formula C19H15NO3S
and a molecular weight of 337.40 g/mol. Its IUPAC name is 3-(2-phenyl-1,3-thiazolidine-3-carbonyl)chromen-2-one.
Molecular Properties
| Compound Name | 3-(2-phenyl-1,3-thiazolidine-3-carbonyl)chromen-2-one |
| PubChem CID | 3123269 |
| Molecular Formula | C19H15NO3S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 3-(2-phenyl-1,3-thiazolidine-3-carbonyl)chromen-2-one |
| SMILES | O=C(c1cc2ccccc2oc1=O)N1CCSC1c1ccccc1 |
| InChI | InChI=1S/C19H15NO3S/c21-17(15-12-14-8-4-5-9-16(14)23-19(15)22)20-10-11-24-18(20)13-6-2-1-3-7-13/h1-9,12,18H,10-11H2 |
| InChIKey | BVNNZVQFZGFQFD-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-phenyl-1,3-thiazolidine-3-carbonyl)chromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-phenyl-1,3-thiazolidine-3-carbonyl)chromen-2-one?
The IUPAC name of 3-(2-phenyl-1,3-thiazolidine-3-carbonyl)chromen-2-one (CID 3123269) is 3-(2-phenyl-1,3-thiazolidine-3-carbonyl)chromen-2-one.
What is the SMILES notation for 3-(2-phenyl-1,3-thiazolidine-3-carbonyl)chromen-2-one?
The canonical SMILES for 3-(2-phenyl-1,3-thiazolidine-3-carbonyl)chromen-2-one is O=C(c1cc2ccccc2oc1=O)N1CCSC1c1ccccc1.
What is the InChIKey of 3-(2-phenyl-1,3-thiazolidine-3-carbonyl)chromen-2-one?
The InChIKey is BVNNZVQFZGFQFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15NO3S/c21-17(15-12-14-8-4-5-9-16(14)23-19(15)22)20-10-11-24-18(20)13-6-2-1-3-7-13/h1-9,12,18H,10-11H2.
What are the key properties of 3-(2-phenyl-1,3-thiazolidine-3-carbonyl)chromen-2-one?
3-(2-phenyl-1,3-thiazolidine-3-carbonyl)chromen-2-one has a molecular weight of 337.40 g/mol, XLogP of 3.68, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-phenyl-1,3-thiazolidine-3-carbonyl)chromen-2-one is sourced from PubChem (CID 3123269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).