About 3-[2-(3,4-dimethoxyphenyl)-1,3-thiazolidine-3-carbonyl]chromen-2-one
3-[2-(3,4-dimethoxyphenyl)-1,3-thiazolidine-3-carbonyl]chromen-2-one (PubChem CID 3123276) has the molecular formula C21H19NO5S
and a molecular weight of 397.45 g/mol. Its IUPAC name is 3-[2-(3,4-dimethoxyphenyl)-1,3-thiazolidine-3-carbonyl]chromen-2-one.
Molecular Properties
| Compound Name | 3-[2-(3,4-dimethoxyphenyl)-1,3-thiazolidine-3-carbonyl]chromen-2-one |
| PubChem CID | 3123276 |
| Molecular Formula | C21H19NO5S |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 3-[2-(3,4-dimethoxyphenyl)-1,3-thiazolidine-3-carbonyl]chromen-2-one |
| SMILES | COc1ccc(C2SCCN2C(=O)c2cc3ccccc3oc2=O)cc1OC |
| InChI | InChI=1S/C21H19NO5S/c1-25-17-8-7-14(12-18(17)26-2)20-22(9-10-28-20)19(23)15-11-13-5-3-4-6-16(13)27-21(15)24/h3-8,11-12,20H,9-10H2,1-2H3 |
| InChIKey | LSHVVRDKKLZRKE-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(3,4-dimethoxyphenyl)-1,3-thiazolidine-3-carbonyl]chromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(3,4-dimethoxyphenyl)-1,3-thiazolidine-3-carbonyl]chromen-2-one?
The IUPAC name of 3-[2-(3,4-dimethoxyphenyl)-1,3-thiazolidine-3-carbonyl]chromen-2-one (CID 3123276) is 3-[2-(3,4-dimethoxyphenyl)-1,3-thiazolidine-3-carbonyl]chromen-2-one.
What is the SMILES notation for 3-[2-(3,4-dimethoxyphenyl)-1,3-thiazolidine-3-carbonyl]chromen-2-one?
The canonical SMILES for 3-[2-(3,4-dimethoxyphenyl)-1,3-thiazolidine-3-carbonyl]chromen-2-one is COc1ccc(C2SCCN2C(=O)c2cc3ccccc3oc2=O)cc1OC.
What is the InChIKey of 3-[2-(3,4-dimethoxyphenyl)-1,3-thiazolidine-3-carbonyl]chromen-2-one?
The InChIKey is LSHVVRDKKLZRKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19NO5S/c1-25-17-8-7-14(12-18(17)26-2)20-22(9-10-28-20)19(23)15-11-13-5-3-4-6-16(13)27-21(15)24/h3-8,11-12,20H,9-10H2,1-2H3.
What are the key properties of 3-[2-(3,4-dimethoxyphenyl)-1,3-thiazolidine-3-carbonyl]chromen-2-one?
3-[2-(3,4-dimethoxyphenyl)-1,3-thiazolidine-3-carbonyl]chromen-2-one has a molecular weight of 397.45 g/mol, XLogP of 3.70, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(3,4-dimethoxyphenyl)-1,3-thiazolidine-3-carbonyl]chromen-2-one is sourced from PubChem (CID 3123276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).