C31H37NO10 — CID 3123307
dibenzyl 2-[(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carbonyl)amino]pentanedioate (PubChem CID 3123307) has the molecular formula C31H37NO10 and a molecular weight of 583.63 g/mol. Its IUPAC name is dibenzyl 2-[(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carbonyl)amino]pentanedioate.
| Compound Name | dibenzyl 2-[(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carbonyl)amino]pentanedioate |
|---|---|
| PubChem CID | 3123307 |
| Molecular Formula | C31H37NO10 |
| Molecular Weight | 583.63 g/mol |
| Exact Mass | 583.24 |
| IUPAC Name | dibenzyl 2-[(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carbonyl)amino]pentanedioate |
| SMILES | CC1(C)OC2OC(C(=O)NC(CCC(=O)OCc3ccccc3)C(=O)OCc3ccccc3)C3OC(C)(C)OC3C2O1 |
| InChI | InChI=1S/C31H37NO10/c1-30(2)39-23-24(40-30)26-29(42-31(3,4)41-26)38-25(23)27(34)32-21(28(35)37-18-20-13-9-6-10-14-20)15-16-22(33)36-17-19-11-7-5-8-12-19/h5-14,21,23-26,29H,15-18H2,1-4H3,(H,32,34) |
| InChIKey | MOUPYPMMLSEMOS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 127.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.63 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |