C15H19N3O4S — CID 31233255
N-[(1,5-dimethylpyrrol-2-yl)methyl]-2-methoxy-5-sulfamoylbenzamide (PubChem CID 31233255) has the molecular formula C15H19N3O4S and a molecular weight of 337.40 g/mol. Its IUPAC name is N-[(1,5-dimethylpyrrol-2-yl)methyl]-2-methoxy-5-sulfamoylbenzamide.
| Compound Name | N-[(1,5-dimethylpyrrol-2-yl)methyl]-2-methoxy-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 31233255 |
| Molecular Formula | C15H19N3O4S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | N-[(1,5-dimethylpyrrol-2-yl)methyl]-2-methoxy-5-sulfamoylbenzamide |
| SMILES | COc1ccc(S(N)(=O)=O)cc1C(=O)NCc1ccc(C)n1C |
| InChI | InChI=1S/C15H19N3O4S/c1-10-4-5-11(18(10)2)9-17-15(19)13-8-12(23(16,20)21)6-7-14(13)22-3/h4-8H,9H2,1-3H3,(H,17,19)(H2,16,20,21) |
| InChIKey | UYWXVEJFFSFFSV-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 103.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |