C20H22N4O2S — CID 31235022
2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 31235022) has the molecular formula C20H22N4O2S and a molecular weight of 382.49 g/mol. Its IUPAC name is 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 31235022 |
| Molecular Formula | C20H22N4O2S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 2-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | Cc1cc(C)c(C#N)c(SCC(=O)Nc2ccc(N3CCOCC3)cc2)n1 |
| InChI | InChI=1S/C20H22N4O2S/c1-14-11-15(2)22-20(18(14)12-21)27-13-19(25)23-16-3-5-17(6-4-16)24-7-9-26-10-8-24/h3-6,11H,7-10,13H2,1-2H3,(H,23,25) |
| InChIKey | VQRFKBDDKKJHKL-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|