C14H14BrNO — CID 3123578
2-(bromomethyl)-4,8-dimethyl-2,3-dihydrofuro[3,2-c]quinoline (PubChem CID 3123578) has the molecular formula C14H14BrNO and a molecular weight of 292.18 g/mol. Its IUPAC name is 2-(bromomethyl)-4,8-dimethyl-2,3-dihydrofuro[3,2-c]quinoline.
| Compound Name | 2-(bromomethyl)-4,8-dimethyl-2,3-dihydrofuro[3,2-c]quinoline |
|---|---|
| PubChem CID | 3123578 |
| Molecular Formula | C14H14BrNO |
| Molecular Weight | 292.18 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | 2-(bromomethyl)-4,8-dimethyl-2,3-dihydrofuro[3,2-c]quinoline |
| SMILES | Cc1ccc2nc(C)c3c(c2c1)OC(CBr)C3 |
| InChI | InChI=1S/C14H14BrNO/c1-8-3-4-13-12(5-8)14-11(9(2)16-13)6-10(7-15)17-14/h3-5,10H,6-7H2,1-2H3 |
| InChIKey | KGUZMVPUAIRYQR-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.18 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|