About H-9/64
H-9/64 (PubChem CID 3123920) has the molecular formula C12H19NO2
and a molecular weight of 209.28 g/mol. Its IUPAC name is 1-phenoxy-3-(propan-2-ylamino)propan-2-ol.
Molecular Properties
| Compound Name | H-9/64 |
| PubChem CID | 3123920 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.28 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 1-phenoxy-3-(propan-2-ylamino)propan-2-ol |
| SMILES | CC(C)NCC(COC1=CC=CC=C1)O |
| InChI | InChI=1S/C12H19NO2/c1-10(2)13-8-11(14)9-15-12-6-4-3-5-7-12/h3-7,10-11,13-14H,8-9H2,1-2H3 |
| InChIKey | ONXLHKFGTDDVLQ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 41.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | 156 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.28 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze H-9/64 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of H-9/64?
The IUPAC name of H-9/64 (CID 3123920) is 1-phenoxy-3-(propan-2-ylamino)propan-2-ol.
What is the SMILES notation for H-9/64?
The canonical SMILES for H-9/64 is CC(C)NCC(COC1=CC=CC=C1)O.
What is the InChIKey of H-9/64?
The InChIKey is ONXLHKFGTDDVLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO2/c1-10(2)13-8-11(14)9-15-12-6-4-3-5-7-12/h3-7,10-11,13-14H,8-9H2,1-2H3.
What are the key properties of H-9/64?
H-9/64 has a molecular weight of 209.28 g/mol, XLogP of 1.70, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for H-9/64 is sourced from PubChem (CID 3123920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).