C16H12N2O3S — CID 3123923
N-(1,3-dioxoisoindol-2-yl)-2-phenylsulfanylacetamide (PubChem CID 3123923) has the molecular formula C16H12N2O3S and a molecular weight of 312.35 g/mol. Its IUPAC name is N-(1,3-dioxoisoindol-2-yl)-2-phenylsulfanylacetamide.
| Compound Name | N-(1,3-dioxoisoindol-2-yl)-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 3123923 |
| Molecular Formula | C16H12N2O3S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | N-(1,3-dioxoisoindol-2-yl)-2-phenylsulfanylacetamide |
| SMILES | O=C(CSc1ccccc1)NN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H12N2O3S/c19-14(10-22-11-6-2-1-3-7-11)17-18-15(20)12-8-4-5-9-13(12)16(18)21/h1-9H,10H2,(H,17,19) |
| InChIKey | JYWOJZSBCMJMLR-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|