C17H21N3O — CID 3124085
2-(12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl)acetamide (PubChem CID 3124085) has the molecular formula C17H21N3O and a molecular weight of 283.38 g/mol. Its IUPAC name is 2-(12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl)acetamide.
| Compound Name | 2-(12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl)acetamide |
|---|---|
| PubChem CID | 3124085 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 2-(12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl)acetamide |
| SMILES | Cc1ccc2c(c1)c1c3n2CCN(CC(N)=O)C3CCC1 |
| InChI | InChI=1S/C17H21N3O/c1-11-5-6-14-13(9-11)12-3-2-4-15-17(12)20(14)8-7-19(15)10-16(18)21/h5-6,9,15H,2-4,7-8,10H2,1H3,(H2,18,21) |
| InChIKey | MYSUKBHPJBSYSG-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 51.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|