About N-(4,6-dinitro-2-oxo-1,3-dihydrobenzimidazol-5-yl)acetamide
N-(4,6-dinitro-2-oxo-1,3-dihydrobenzimidazol-5-yl)acetamide (PubChem CID 3124533) has the molecular formula C9H7N5O6
and a molecular weight of 281.18 g/mol. Its IUPAC name is N-(4,6-dinitro-2-oxo-1,3-dihydrobenzimidazol-5-yl)acetamide.
Molecular Properties
| Compound Name | N-(4,6-dinitro-2-oxo-1,3-dihydrobenzimidazol-5-yl)acetamide |
| PubChem CID | 3124533 |
| Molecular Formula | C9H7N5O6 |
| Molecular Weight | 281.18 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | N-(4,6-dinitro-2-oxo-1,3-dihydrobenzimidazol-5-yl)acetamide |
| SMILES | CC(=O)Nc1c([N+](=O)[O-])cc2[nH]c(=O)[nH]c2c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H7N5O6/c1-3(15)10-7-5(13(17)18)2-4-6(8(7)14(19)20)12-9(16)11-4/h2H,1H3,(H,10,15)(H2,11,12,16) |
| InChIKey | FEIFDAYRICNYMG-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 164.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.18 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(4,6-dinitro-2-oxo-1,3-dihydrobenzimidazol-5-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,6-dinitro-2-oxo-1,3-dihydrobenzimidazol-5-yl)acetamide?
The IUPAC name of N-(4,6-dinitro-2-oxo-1,3-dihydrobenzimidazol-5-yl)acetamide (CID 3124533) is N-(4,6-dinitro-2-oxo-1,3-dihydrobenzimidazol-5-yl)acetamide.
What is the SMILES notation for N-(4,6-dinitro-2-oxo-1,3-dihydrobenzimidazol-5-yl)acetamide?
The canonical SMILES for N-(4,6-dinitro-2-oxo-1,3-dihydrobenzimidazol-5-yl)acetamide is CC(=O)Nc1c([N+](=O)[O-])cc2[nH]c(=O)[nH]c2c1[N+](=O)[O-].
What is the InChIKey of N-(4,6-dinitro-2-oxo-1,3-dihydrobenzimidazol-5-yl)acetamide?
The InChIKey is FEIFDAYRICNYMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N5O6/c1-3(15)10-7-5(13(17)18)2-4-6(8(7)14(19)20)12-9(16)11-4/h2H,1H3,(H,10,15)(H2,11,12,16).
What are the key properties of N-(4,6-dinitro-2-oxo-1,3-dihydrobenzimidazol-5-yl)acetamide?
N-(4,6-dinitro-2-oxo-1,3-dihydrobenzimidazol-5-yl)acetamide has a molecular weight of 281.18 g/mol, XLogP of 0.63, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,6-dinitro-2-oxo-1,3-dihydrobenzimidazol-5-yl)acetamide is sourced from PubChem (CID 3124533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).