About (4-methylpyrimidin-2-yl) N-(2-methyl-5-nitrophenyl)-3-nitrobenzenecarboximidothioate
(4-methylpyrimidin-2-yl) N-(2-methyl-5-nitrophenyl)-3-nitrobenzenecarboximidothioate (PubChem CID 3124576) has the molecular formula C19H15N5O4S
and a molecular weight of 409.43 g/mol. Its IUPAC name is (4-methylpyrimidin-2-yl) N-(2-methyl-5-nitrophenyl)-3-nitrobenzenecarboximidothioate.
Molecular Properties
| Compound Name | (4-methylpyrimidin-2-yl) N-(2-methyl-5-nitrophenyl)-3-nitrobenzenecarboximidothioate |
| PubChem CID | 3124576 |
| Molecular Formula | C19H15N5O4S |
| Molecular Weight | 409.43 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | (4-methylpyrimidin-2-yl) N-(2-methyl-5-nitrophenyl)-3-nitrobenzenecarboximidothioate |
| SMILES | Cc1ccnc(S/C(=N\c2cc([N+](=O)[O-])ccc2C)c2cccc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C19H15N5O4S/c1-12-6-7-16(24(27)28)11-17(12)22-18(29-19-20-9-8-13(2)21-19)14-4-3-5-15(10-14)23(25)26/h3-11H,1-2H3/b22-18- |
| InChIKey | QWTMTCOQMRRNJO-PYCFMQQDSA-N |
| XLogP | 4.78 |
| TPSA | 124.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.43 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-methylpyrimidin-2-yl) N-(2-methyl-5-nitrophenyl)-3-nitrobenzenecarboximidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylpyrimidin-2-yl) N-(2-methyl-5-nitrophenyl)-3-nitrobenzenecarboximidothioate?
The IUPAC name of (4-methylpyrimidin-2-yl) N-(2-methyl-5-nitrophenyl)-3-nitrobenzenecarboximidothioate (CID 3124576) is (4-methylpyrimidin-2-yl) N-(2-methyl-5-nitrophenyl)-3-nitrobenzenecarboximidothioate.
What is the SMILES notation for (4-methylpyrimidin-2-yl) N-(2-methyl-5-nitrophenyl)-3-nitrobenzenecarboximidothioate?
The canonical SMILES for (4-methylpyrimidin-2-yl) N-(2-methyl-5-nitrophenyl)-3-nitrobenzenecarboximidothioate is Cc1ccnc(S/C(=N\c2cc([N+](=O)[O-])ccc2C)c2cccc([N+](=O)[O-])c2)n1.
What is the InChIKey of (4-methylpyrimidin-2-yl) N-(2-methyl-5-nitrophenyl)-3-nitrobenzenecarboximidothioate?
The InChIKey is QWTMTCOQMRRNJO-PYCFMQQDSA-N. The full InChI is InChI=1S/C19H15N5O4S/c1-12-6-7-16(24(27)28)11-17(12)22-18(29-19-20-9-8-13(2)21-19)14-4-3-5-15(10-14)23(25)26/h3-11H,1-2H3/b22-18-.
What are the key properties of (4-methylpyrimidin-2-yl) N-(2-methyl-5-nitrophenyl)-3-nitrobenzenecarboximidothioate?
(4-methylpyrimidin-2-yl) N-(2-methyl-5-nitrophenyl)-3-nitrobenzenecarboximidothioate has a molecular weight of 409.43 g/mol, XLogP of 4.78, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylpyrimidin-2-yl) N-(2-methyl-5-nitrophenyl)-3-nitrobenzenecarboximidothioate is sourced from PubChem (CID 3124576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).