C10H16F4N2O4 — CID 3124695
2,2,3,3-tetrafluoro-N,N'-bis(3-hydroxypropyl)butanediamide (PubChem CID 3124695) has the molecular formula C10H16F4N2O4 and a molecular weight of 304.24 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N,N'-bis(3-hydroxypropyl)butanediamide.
| Compound Name | 2,2,3,3-tetrafluoro-N,N'-bis(3-hydroxypropyl)butanediamide |
|---|---|
| PubChem CID | 3124695 |
| Molecular Formula | C10H16F4N2O4 |
| Molecular Weight | 304.24 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N,N'-bis(3-hydroxypropyl)butanediamide |
| SMILES | O=C(NCCCO)C(F)(F)C(F)(F)C(=O)NCCCO |
| InChI | InChI=1S/C10H16F4N2O4/c11-9(12,7(19)15-3-1-5-17)10(13,14)8(20)16-4-2-6-18/h17-18H,1-6H2,(H,15,19)(H,16,20) |
| InChIKey | MERKVUJEQWKULM-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.24 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|