About 2-(N-benzyl-2,4-dinitroanilino)ethanol
2-(N-benzyl-2,4-dinitroanilino)ethanol (PubChem CID 3124718) has the molecular formula C15H15N3O5
and a molecular weight of 317.30 g/mol. Its IUPAC name is 2-(N-benzyl-2,4-dinitroanilino)ethanol.
Molecular Properties
| Compound Name | 2-(N-benzyl-2,4-dinitroanilino)ethanol |
| PubChem CID | 3124718 |
| Molecular Formula | C15H15N3O5 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 2-(N-benzyl-2,4-dinitroanilino)ethanol |
| SMILES | O=[N+]([O-])c1ccc(N(CCO)Cc2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H15N3O5/c19-9-8-16(11-12-4-2-1-3-5-12)14-7-6-13(17(20)21)10-15(14)18(22)23/h1-7,10,19H,8-9,11H2 |
| InChIKey | PFECLVYMQFPSHP-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(N-benzyl-2,4-dinitroanilino)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(N-benzyl-2,4-dinitroanilino)ethanol?
The IUPAC name of 2-(N-benzyl-2,4-dinitroanilino)ethanol (CID 3124718) is 2-(N-benzyl-2,4-dinitroanilino)ethanol.
What is the SMILES notation for 2-(N-benzyl-2,4-dinitroanilino)ethanol?
The canonical SMILES for 2-(N-benzyl-2,4-dinitroanilino)ethanol is O=[N+]([O-])c1ccc(N(CCO)Cc2ccccc2)c([N+](=O)[O-])c1.
What is the InChIKey of 2-(N-benzyl-2,4-dinitroanilino)ethanol?
The InChIKey is PFECLVYMQFPSHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3O5/c19-9-8-16(11-12-4-2-1-3-5-12)14-7-6-13(17(20)21)10-15(14)18(22)23/h1-7,10,19H,8-9,11H2.
What are the key properties of 2-(N-benzyl-2,4-dinitroanilino)ethanol?
2-(N-benzyl-2,4-dinitroanilino)ethanol has a molecular weight of 317.30 g/mol, XLogP of 2.50, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(N-benzyl-2,4-dinitroanilino)ethanol is sourced from PubChem (CID 3124718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).