C21H12Cl2F3N5O3 — CID 3124916
3-chloro-N-(2-chloro-4-nitrophenyl)-5-(4-methylphenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 3124916) has the molecular formula C21H12Cl2F3N5O3 and a molecular weight of 510.26 g/mol. Its IUPAC name is 3-chloro-N-(2-chloro-4-nitrophenyl)-5-(4-methylphenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | 3-chloro-N-(2-chloro-4-nitrophenyl)-5-(4-methylphenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 3124916 |
| Molecular Formula | C21H12Cl2F3N5O3 |
| Molecular Weight | 510.26 g/mol |
| Exact Mass | 509.03 |
| IUPAC Name | 3-chloro-N-(2-chloro-4-nitrophenyl)-5-(4-methylphenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(F)(F)F)n3nc(C(=O)Nc4ccc([N+](=O)[O-])cc4Cl)c(Cl)c3n2)cc1 |
| InChI | InChI=1S/C21H12Cl2F3N5O3/c1-10-2-4-11(5-3-10)15-9-16(21(24,25)26)30-19(27-15)17(23)18(29-30)20(32)28-14-7-6-12(31(33)34)8-13(14)22/h2-9H,1H3,(H,28,32) |
| InChIKey | GHVCQYLBLLQJJN-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.26 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|