C9H6F7N5 — CID 3124959
3-(1,1,2,2,3,3,3-heptafluoropropyl)-N-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine (PubChem CID 3124959) has the molecular formula C9H6F7N5 and a molecular weight of 317.17 g/mol. Its IUPAC name is 3-(1,1,2,2,3,3,3-heptafluoropropyl)-N-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine.
| Compound Name | 3-(1,1,2,2,3,3,3-heptafluoropropyl)-N-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 3124959 |
| Molecular Formula | C9H6F7N5 |
| Molecular Weight | 317.17 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 3-(1,1,2,2,3,3,3-heptafluoropropyl)-N-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
| SMILES | CNc1ccc2nnc(C(F)(F)C(F)(F)C(F)(F)F)n2n1 |
| InChI | InChI=1S/C9H6F7N5/c1-17-4-2-3-5-18-19-6(21(5)20-4)7(10,11)8(12,13)9(14,15)16/h2-3H,1H3,(H,17,20) |
| InChIKey | GCBFSCSGHCLRLQ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.17 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|