C20H16N6O2S — CID 31253990
2-[[4-(2,4-dimethylphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]-5-nitropyridine (PubChem CID 31253990) has the molecular formula C20H16N6O2S and a molecular weight of 404.46 g/mol. Its IUPAC name is 2-[[4-(2,4-dimethylphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]-5-nitropyridine.
| Compound Name | 2-[[4-(2,4-dimethylphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]-5-nitropyridine |
|---|---|
| PubChem CID | 31253990 |
| Molecular Formula | C20H16N6O2S |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 2-[[4-(2,4-dimethylphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]-5-nitropyridine |
| SMILES | Cc1ccc(-n2c(Sc3ccc([N+](=O)[O-])cn3)nnc2-c2cccnc2)c(C)c1 |
| InChI | InChI=1S/C20H16N6O2S/c1-13-5-7-17(14(2)10-13)25-19(15-4-3-9-21-11-15)23-24-20(25)29-18-8-6-16(12-22-18)26(27)28/h3-12H,1-2H3 |
| InChIKey | RZBPPZWBAVGTBH-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 99.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|