About 2-[[4,5-bis(4-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-5-nitropyridine
2-[[4,5-bis(4-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-5-nitropyridine (PubChem CID 31254654) has the molecular formula C19H11F2N5O2S
and a molecular weight of 411.39 g/mol. Its IUPAC name is 2-[[4,5-bis(4-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-5-nitropyridine.
Molecular Properties
| Compound Name | 2-[[4,5-bis(4-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-5-nitropyridine |
| PubChem CID | 31254654 |
| Molecular Formula | C19H11F2N5O2S |
| Molecular Weight | 411.39 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | 2-[[4,5-bis(4-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-5-nitropyridine |
| SMILES | O=[N+]([O-])c1ccc(Sc2nnc(-c3ccc(F)cc3)n2-c2ccc(F)cc2)nc1 |
| InChI | InChI=1S/C19H11F2N5O2S/c20-13-3-1-12(2-4-13)18-23-24-19(25(18)15-7-5-14(21)6-8-15)29-17-10-9-16(11-22-17)26(27)28/h1-11H |
| InChIKey | VAJJCVDNKNBMCI-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.39 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[[4,5-bis(4-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-5-nitropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4,5-bis(4-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-5-nitropyridine?
The IUPAC name of 2-[[4,5-bis(4-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-5-nitropyridine (CID 31254654) is 2-[[4,5-bis(4-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-5-nitropyridine.
What is the SMILES notation for 2-[[4,5-bis(4-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-5-nitropyridine?
The canonical SMILES for 2-[[4,5-bis(4-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-5-nitropyridine is O=[N+]([O-])c1ccc(Sc2nnc(-c3ccc(F)cc3)n2-c2ccc(F)cc2)nc1.
What is the InChIKey of 2-[[4,5-bis(4-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-5-nitropyridine?
The InChIKey is VAJJCVDNKNBMCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H11F2N5O2S/c20-13-3-1-12(2-4-13)18-23-24-19(25(18)15-7-5-14(21)6-8-15)29-17-10-9-16(11-22-17)26(27)28/h1-11H.
What are the key properties of 2-[[4,5-bis(4-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-5-nitropyridine?
2-[[4,5-bis(4-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-5-nitropyridine has a molecular weight of 411.39 g/mol, XLogP of 4.67, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4,5-bis(4-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-5-nitropyridine is sourced from PubChem (CID 31254654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).