About methyl 5'-acetyl-2'-amino-5-bromo-2-oxo-6'-phenylspiro[1H-indole-3,4'-pyran]-3'-carboxylate
methyl 5'-acetyl-2'-amino-5-bromo-2-oxo-6'-phenylspiro[1H-indole-3,4'-pyran]-3'-carboxylate (PubChem CID 3125777) has the molecular formula C22H17BrN2O5
and a molecular weight of 469.29 g/mol. Its IUPAC name is methyl 5'-acetyl-2'-amino-5-bromo-2-oxo-6'-phenylspiro[1H-indole-3,4'-pyran]-3'-carboxylate.
Molecular Properties
| Compound Name | methyl 5'-acetyl-2'-amino-5-bromo-2-oxo-6'-phenylspiro[1H-indole-3,4'-pyran]-3'-carboxylate |
| PubChem CID | 3125777 |
| Molecular Formula | C22H17BrN2O5 |
| Molecular Weight | 469.29 g/mol |
| Exact Mass | 468.03 |
| IUPAC Name | methyl 5'-acetyl-2'-amino-5-bromo-2-oxo-6'-phenylspiro[1H-indole-3,4'-pyran]-3'-carboxylate |
| SMILES | COC(=O)C1=C(N)OC(c2ccccc2)=C(C(C)=O)C12C(=O)Nc1ccc(Br)cc12 |
| InChI | InChI=1S/C22H17BrN2O5/c1-11(26)16-18(12-6-4-3-5-7-12)30-19(24)17(20(27)29-2)22(16)14-10-13(23)8-9-15(14)25-21(22)28/h3-10H,24H2,1-2H3,(H,25,28) |
| InChIKey | YUAIYPHHPQAJOT-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 469.29 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 5'-acetyl-2'-amino-5-bromo-2-oxo-6'-phenylspiro[1H-indole-3,4'-pyran]-3'-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5'-acetyl-2'-amino-5-bromo-2-oxo-6'-phenylspiro[1H-indole-3,4'-pyran]-3'-carboxylate?
The IUPAC name of methyl 5'-acetyl-2'-amino-5-bromo-2-oxo-6'-phenylspiro[1H-indole-3,4'-pyran]-3'-carboxylate (CID 3125777) is methyl 5'-acetyl-2'-amino-5-bromo-2-oxo-6'-phenylspiro[1H-indole-3,4'-pyran]-3'-carboxylate.
What is the SMILES notation for methyl 5'-acetyl-2'-amino-5-bromo-2-oxo-6'-phenylspiro[1H-indole-3,4'-pyran]-3'-carboxylate?
The canonical SMILES for methyl 5'-acetyl-2'-amino-5-bromo-2-oxo-6'-phenylspiro[1H-indole-3,4'-pyran]-3'-carboxylate is COC(=O)C1=C(N)OC(c2ccccc2)=C(C(C)=O)C12C(=O)Nc1ccc(Br)cc12.
What is the InChIKey of methyl 5'-acetyl-2'-amino-5-bromo-2-oxo-6'-phenylspiro[1H-indole-3,4'-pyran]-3'-carboxylate?
The InChIKey is YUAIYPHHPQAJOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17BrN2O5/c1-11(26)16-18(12-6-4-3-5-7-12)30-19(24)17(20(27)29-2)22(16)14-10-13(23)8-9-15(14)25-21(22)28/h3-10H,24H2,1-2H3,(H,25,28).
What are the key properties of methyl 5'-acetyl-2'-amino-5-bromo-2-oxo-6'-phenylspiro[1H-indole-3,4'-pyran]-3'-carboxylate?
methyl 5'-acetyl-2'-amino-5-bromo-2-oxo-6'-phenylspiro[1H-indole-3,4'-pyran]-3'-carboxylate has a molecular weight of 469.29 g/mol, XLogP of 3.01, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5'-acetyl-2'-amino-5-bromo-2-oxo-6'-phenylspiro[1H-indole-3,4'-pyran]-3'-carboxylate is sourced from PubChem (CID 3125777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).