About tert-butyl 6'-amino-5-bromo-5'-cyano-2'-methyl-2-oxospiro[1H-indole-3,4'-pyran]-3'-carboxylate
tert-butyl 6'-amino-5-bromo-5'-cyano-2'-methyl-2-oxospiro[1H-indole-3,4'-pyran]-3'-carboxylate (PubChem CID 3125783) has the molecular formula C19H18BrN3O4
and a molecular weight of 432.27 g/mol. Its IUPAC name is tert-butyl 6'-amino-5-bromo-5'-cyano-2'-methyl-2-oxospiro[1H-indole-3,4'-pyran]-3'-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 6'-amino-5-bromo-5'-cyano-2'-methyl-2-oxospiro[1H-indole-3,4'-pyran]-3'-carboxylate |
| PubChem CID | 3125783 |
| Molecular Formula | C19H18BrN3O4 |
| Molecular Weight | 432.27 g/mol |
| Exact Mass | 431.05 |
| IUPAC Name | tert-butyl 6'-amino-5-bromo-5'-cyano-2'-methyl-2-oxospiro[1H-indole-3,4'-pyran]-3'-carboxylate |
| SMILES | CC1=C(C(=O)OC(C)(C)C)C2(C(=O)Nc3ccc(Br)cc32)C(C#N)=C(N)O1 |
| InChI | InChI=1S/C19H18BrN3O4/c1-9-14(16(24)27-18(2,3)4)19(12(8-21)15(22)26-9)11-7-10(20)5-6-13(11)23-17(19)25/h5-7H,22H2,1-4H3,(H,23,25) |
| InChIKey | SMRVBAUQWVAIOB-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 114.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.27 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl 6'-amino-5-bromo-5'-cyano-2'-methyl-2-oxospiro[1H-indole-3,4'-pyran]-3'-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 6'-amino-5-bromo-5'-cyano-2'-methyl-2-oxospiro[1H-indole-3,4'-pyran]-3'-carboxylate?
The IUPAC name of tert-butyl 6'-amino-5-bromo-5'-cyano-2'-methyl-2-oxospiro[1H-indole-3,4'-pyran]-3'-carboxylate (CID 3125783) is tert-butyl 6'-amino-5-bromo-5'-cyano-2'-methyl-2-oxospiro[1H-indole-3,4'-pyran]-3'-carboxylate.
What is the SMILES notation for tert-butyl 6'-amino-5-bromo-5'-cyano-2'-methyl-2-oxospiro[1H-indole-3,4'-pyran]-3'-carboxylate?
The canonical SMILES for tert-butyl 6'-amino-5-bromo-5'-cyano-2'-methyl-2-oxospiro[1H-indole-3,4'-pyran]-3'-carboxylate is CC1=C(C(=O)OC(C)(C)C)C2(C(=O)Nc3ccc(Br)cc32)C(C#N)=C(N)O1.
What is the InChIKey of tert-butyl 6'-amino-5-bromo-5'-cyano-2'-methyl-2-oxospiro[1H-indole-3,4'-pyran]-3'-carboxylate?
The InChIKey is SMRVBAUQWVAIOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18BrN3O4/c1-9-14(16(24)27-18(2,3)4)19(12(8-21)15(22)26-9)11-7-10(20)5-6-13(11)23-17(19)25/h5-7H,22H2,1-4H3,(H,23,25).
What are the key properties of tert-butyl 6'-amino-5-bromo-5'-cyano-2'-methyl-2-oxospiro[1H-indole-3,4'-pyran]-3'-carboxylate?
tert-butyl 6'-amino-5-bromo-5'-cyano-2'-methyl-2-oxospiro[1H-indole-3,4'-pyran]-3'-carboxylate has a molecular weight of 432.27 g/mol, XLogP of 2.98, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 6'-amino-5-bromo-5'-cyano-2'-methyl-2-oxospiro[1H-indole-3,4'-pyran]-3'-carboxylate is sourced from PubChem (CID 3125783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).