About (4-hydroxy-1,1-dioxothiolan-3-yl) benzenesulfonate
(4-hydroxy-1,1-dioxothiolan-3-yl) benzenesulfonate (PubChem CID 3125838) has the molecular formula C10H12O6S2
and a molecular weight of 292.33 g/mol. Its IUPAC name is (4-hydroxy-1,1-dioxothiolan-3-yl) benzenesulfonate.
Molecular Properties
| Compound Name | (4-hydroxy-1,1-dioxothiolan-3-yl) benzenesulfonate |
| PubChem CID | 3125838 |
| Molecular Formula | C10H12O6S2 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | (4-hydroxy-1,1-dioxothiolan-3-yl) benzenesulfonate |
| SMILES | O=S1(=O)CC(O)C(OS(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C10H12O6S2/c11-9-6-17(12,13)7-10(9)16-18(14,15)8-4-2-1-3-5-8/h1-5,9-11H,6-7H2 |
| InChIKey | XTTGVQCQBGRQSH-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (4-hydroxy-1,1-dioxothiolan-3-yl) benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-hydroxy-1,1-dioxothiolan-3-yl) benzenesulfonate?
The IUPAC name of (4-hydroxy-1,1-dioxothiolan-3-yl) benzenesulfonate (CID 3125838) is (4-hydroxy-1,1-dioxothiolan-3-yl) benzenesulfonate.
What is the SMILES notation for (4-hydroxy-1,1-dioxothiolan-3-yl) benzenesulfonate?
The canonical SMILES for (4-hydroxy-1,1-dioxothiolan-3-yl) benzenesulfonate is O=S1(=O)CC(O)C(OS(=O)(=O)c2ccccc2)C1.
What is the InChIKey of (4-hydroxy-1,1-dioxothiolan-3-yl) benzenesulfonate?
The InChIKey is XTTGVQCQBGRQSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O6S2/c11-9-6-17(12,13)7-10(9)16-18(14,15)8-4-2-1-3-5-8/h1-5,9-11H,6-7H2.
What are the key properties of (4-hydroxy-1,1-dioxothiolan-3-yl) benzenesulfonate?
(4-hydroxy-1,1-dioxothiolan-3-yl) benzenesulfonate has a molecular weight of 292.33 g/mol, XLogP of -0.45, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-hydroxy-1,1-dioxothiolan-3-yl) benzenesulfonate is sourced from PubChem (CID 3125838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).