C19H18ClN3O2 — CID 3125843
5-chloro-2-[[(4-methylquinolin-8-yl)amino]methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 3125843) has the molecular formula C19H18ClN3O2 and a molecular weight of 355.83 g/mol. Its IUPAC name is 5-chloro-2-[[(4-methylquinolin-8-yl)amino]methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 5-chloro-2-[[(4-methylquinolin-8-yl)amino]methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 3125843 |
| Molecular Formula | C19H18ClN3O2 |
| Molecular Weight | 355.83 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 5-chloro-2-[[(4-methylquinolin-8-yl)amino]methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | Cc1ccnc2c(NCN3C(=O)C4CC=C(Cl)CC4C3=O)cccc12 |
| InChI | InChI=1S/C19H18ClN3O2/c1-11-7-8-21-17-13(11)3-2-4-16(17)22-10-23-18(24)14-6-5-12(20)9-15(14)19(23)25/h2-5,7-8,14-15,22H,6,9-10H2,1H3 |
| InChIKey | UZVXBOZLAOVJJF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.83 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|