About Isoamyl Alcohol
Isoamyl Alcohol (PubChem CID 31260) has the molecular formula C5H12O
and a molecular weight of 88.15 g/mol. Its IUPAC name is 3-methylbutan-1-ol.
Molecular Properties
| Compound Name | Isoamyl Alcohol |
| PubChem CID | 31260 |
| Molecular Formula | C5H12O |
| Molecular Weight | 88.15 g/mol |
| Exact Mass | 88.09 |
| IUPAC Name | 3-methylbutan-1-ol |
| SMILES | CC(C)CCO |
| InChI | InChI=1S/C5H12O/c1-5(2)3-4-6/h5-6H,3-4H2,1-2H3 |
| InChIKey | PHTQWCKDNZKARW-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | 25 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 88.15 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze Isoamyl Alcohol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Isoamyl Alcohol?
The IUPAC name of Isoamyl Alcohol (CID 31260) is 3-methylbutan-1-ol.
What is the SMILES notation for Isoamyl Alcohol?
The canonical SMILES for Isoamyl Alcohol is CC(C)CCO.
What is the InChIKey of Isoamyl Alcohol?
The InChIKey is PHTQWCKDNZKARW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O/c1-5(2)3-4-6/h5-6H,3-4H2,1-2H3.
What are the key properties of Isoamyl Alcohol?
Isoamyl Alcohol has a molecular weight of 88.15 g/mol, XLogP of 1.20, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Isoamyl Alcohol is sourced from PubChem (CID 31260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).