About (4-methylphenyl) 1-hydroxy-9,10-dioxoanthracene-2-carboxylate
(4-methylphenyl) 1-hydroxy-9,10-dioxoanthracene-2-carboxylate (PubChem CID 3126046) has the molecular formula C22H14O5
and a molecular weight of 358.35 g/mol. Its IUPAC name is (4-methylphenyl) 1-hydroxy-9,10-dioxoanthracene-2-carboxylate.
Molecular Properties
| Compound Name | (4-methylphenyl) 1-hydroxy-9,10-dioxoanthracene-2-carboxylate |
| PubChem CID | 3126046 |
| Molecular Formula | C22H14O5 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | (4-methylphenyl) 1-hydroxy-9,10-dioxoanthracene-2-carboxylate |
| SMILES | Cc1ccc(OC(=O)c2ccc3c(c2O)C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C22H14O5/c1-12-6-8-13(9-7-12)27-22(26)17-11-10-16-18(21(17)25)20(24)15-5-3-2-4-14(15)19(16)23/h2-11,25H,1H3 |
| InChIKey | ATDLZCXEHJGEAW-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-methylphenyl) 1-hydroxy-9,10-dioxoanthracene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylphenyl) 1-hydroxy-9,10-dioxoanthracene-2-carboxylate?
The IUPAC name of (4-methylphenyl) 1-hydroxy-9,10-dioxoanthracene-2-carboxylate (CID 3126046) is (4-methylphenyl) 1-hydroxy-9,10-dioxoanthracene-2-carboxylate.
What is the SMILES notation for (4-methylphenyl) 1-hydroxy-9,10-dioxoanthracene-2-carboxylate?
The canonical SMILES for (4-methylphenyl) 1-hydroxy-9,10-dioxoanthracene-2-carboxylate is Cc1ccc(OC(=O)c2ccc3c(c2O)C(=O)c2ccccc2C3=O)cc1.
What is the InChIKey of (4-methylphenyl) 1-hydroxy-9,10-dioxoanthracene-2-carboxylate?
The InChIKey is ATDLZCXEHJGEAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H14O5/c1-12-6-8-13(9-7-12)27-22(26)17-11-10-16-18(21(17)25)20(24)15-5-3-2-4-14(15)19(16)23/h2-11,25H,1H3.
What are the key properties of (4-methylphenyl) 1-hydroxy-9,10-dioxoanthracene-2-carboxylate?
(4-methylphenyl) 1-hydroxy-9,10-dioxoanthracene-2-carboxylate has a molecular weight of 358.35 g/mol, XLogP of 3.70, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylphenyl) 1-hydroxy-9,10-dioxoanthracene-2-carboxylate is sourced from PubChem (CID 3126046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).