C16H12N2O8 — CID 3126152
1,2-bis(4-methoxy-3-nitrophenyl)ethane-1,2-dione (PubChem CID 3126152) has the molecular formula C16H12N2O8 and a molecular weight of 360.28 g/mol. Its IUPAC name is 1,2-bis(4-methoxy-3-nitrophenyl)ethane-1,2-dione.
| Compound Name | 1,2-bis(4-methoxy-3-nitrophenyl)ethane-1,2-dione |
|---|---|
| PubChem CID | 3126152 |
| Molecular Formula | C16H12N2O8 |
| Molecular Weight | 360.28 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | 1,2-bis(4-methoxy-3-nitrophenyl)ethane-1,2-dione |
| SMILES | COc1ccc(C(=O)C(=O)c2ccc(OC)c([N+](=O)[O-])c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H12N2O8/c1-25-13-5-3-9(7-11(13)17(21)22)15(19)16(20)10-4-6-14(26-2)12(8-10)18(23)24/h3-8H,1-2H3 |
| InChIKey | QXCBKMMPXQYFNB-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 138.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.28 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|