C19H24N2O2S — CID 3126404
2-(azepan-1-yl)-5-[(2-propoxyphenyl)methylidene]-1,3-thiazol-4-one (PubChem CID 3126404) has the molecular formula C19H24N2O2S and a molecular weight of 344.48 g/mol. Its IUPAC name is 2-(azepan-1-yl)-5-[(2-propoxyphenyl)methylidene]-1,3-thiazol-4-one.
| Compound Name | 2-(azepan-1-yl)-5-[(2-propoxyphenyl)methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 3126404 |
| Molecular Formula | C19H24N2O2S |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 2-(azepan-1-yl)-5-[(2-propoxyphenyl)methylidene]-1,3-thiazol-4-one |
| SMILES | CCCOc1ccccc1C=C1SC(N2CCCCCC2)=NC1=O |
| InChI | InChI=1S/C19H24N2O2S/c1-2-13-23-16-10-6-5-9-15(16)14-17-18(22)20-19(24-17)21-11-7-3-4-8-12-21/h5-6,9-10,14H,2-4,7-8,11-13H2,1H3 |
| InChIKey | ALONRKKJLVBFEJ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|