About N-(5-nitro-1,3-thiazol-2-yl)-1,3-benzodioxole-5-carboxamide
N-(5-nitro-1,3-thiazol-2-yl)-1,3-benzodioxole-5-carboxamide (PubChem CID 3126531) has the molecular formula C11H7N3O5S
and a molecular weight of 293.26 g/mol. Its IUPAC name is N-(5-nitro-1,3-thiazol-2-yl)-1,3-benzodioxole-5-carboxamide.
Molecular Properties
| Compound Name | N-(5-nitro-1,3-thiazol-2-yl)-1,3-benzodioxole-5-carboxamide |
| PubChem CID | 3126531 |
| Molecular Formula | C11H7N3O5S |
| Molecular Weight | 293.26 g/mol |
| Exact Mass | 293.01 |
| IUPAC Name | N-(5-nitro-1,3-thiazol-2-yl)-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(Nc1ncc([N+](=O)[O-])s1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C11H7N3O5S/c15-10(13-11-12-4-9(20-11)14(16)17)6-1-2-7-8(3-6)19-5-18-7/h1-4H,5H2,(H,12,13,15) |
| InChIKey | BQBORCXDKZDXKB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.26 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(5-nitro-1,3-thiazol-2-yl)-1,3-benzodioxole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-nitro-1,3-thiazol-2-yl)-1,3-benzodioxole-5-carboxamide?
The IUPAC name of N-(5-nitro-1,3-thiazol-2-yl)-1,3-benzodioxole-5-carboxamide (CID 3126531) is N-(5-nitro-1,3-thiazol-2-yl)-1,3-benzodioxole-5-carboxamide.
What is the SMILES notation for N-(5-nitro-1,3-thiazol-2-yl)-1,3-benzodioxole-5-carboxamide?
The canonical SMILES for N-(5-nitro-1,3-thiazol-2-yl)-1,3-benzodioxole-5-carboxamide is O=C(Nc1ncc([N+](=O)[O-])s1)c1ccc2c(c1)OCO2.
What is the InChIKey of N-(5-nitro-1,3-thiazol-2-yl)-1,3-benzodioxole-5-carboxamide?
The InChIKey is BQBORCXDKZDXKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7N3O5S/c15-10(13-11-12-4-9(20-11)14(16)17)6-1-2-7-8(3-6)19-5-18-7/h1-4H,5H2,(H,12,13,15).
What are the key properties of N-(5-nitro-1,3-thiazol-2-yl)-1,3-benzodioxole-5-carboxamide?
N-(5-nitro-1,3-thiazol-2-yl)-1,3-benzodioxole-5-carboxamide has a molecular weight of 293.26 g/mol, XLogP of 2.03, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-nitro-1,3-thiazol-2-yl)-1,3-benzodioxole-5-carboxamide is sourced from PubChem (CID 3126531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).