About 4-acetyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)-1H-pyrrole-2-carboxamide
4-acetyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)-1H-pyrrole-2-carboxamide (PubChem CID 31265446) has the molecular formula C10H10N4O2S
and a molecular weight of 250.28 g/mol. Its IUPAC name is 4-acetyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)-1H-pyrrole-2-carboxamide.
Molecular Properties
| Compound Name | 4-acetyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)-1H-pyrrole-2-carboxamide |
| PubChem CID | 31265446 |
| Molecular Formula | C10H10N4O2S |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 4-acetyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)-1H-pyrrole-2-carboxamide |
| SMILES | CC(=O)c1c[nH]c(C(=O)Nc2nnc(C)s2)c1 |
| InChI | InChI=1S/C10H10N4O2S/c1-5(15)7-3-8(11-4-7)9(16)12-10-14-13-6(2)17-10/h3-4,11H,1-2H3,(H,12,14,16) |
| InChIKey | IRWSECXWDDNUMY-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-acetyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)-1H-pyrrole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-acetyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)-1H-pyrrole-2-carboxamide?
The IUPAC name of 4-acetyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)-1H-pyrrole-2-carboxamide (CID 31265446) is 4-acetyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)-1H-pyrrole-2-carboxamide.
What is the SMILES notation for 4-acetyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)-1H-pyrrole-2-carboxamide?
The canonical SMILES for 4-acetyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)-1H-pyrrole-2-carboxamide is CC(=O)c1c[nH]c(C(=O)Nc2nnc(C)s2)c1.
What is the InChIKey of 4-acetyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)-1H-pyrrole-2-carboxamide?
The InChIKey is IRWSECXWDDNUMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N4O2S/c1-5(15)7-3-8(11-4-7)9(16)12-10-14-13-6(2)17-10/h3-4,11H,1-2H3,(H,12,14,16).
What are the key properties of 4-acetyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)-1H-pyrrole-2-carboxamide?
4-acetyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)-1H-pyrrole-2-carboxamide has a molecular weight of 250.28 g/mol, XLogP of 1.63, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-acetyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)-1H-pyrrole-2-carboxamide is sourced from PubChem (CID 31265446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).