C14H17F3N4O5 — CID 3126579
N-(3-morpholin-4-ylpropyl)-2,6-dinitro-4-(trifluoromethyl)aniline (PubChem CID 3126579) has the molecular formula C14H17F3N4O5 and a molecular weight of 378.31 g/mol. Its IUPAC name is N-(3-morpholin-4-ylpropyl)-2,6-dinitro-4-(trifluoromethyl)aniline.
| Compound Name | N-(3-morpholin-4-ylpropyl)-2,6-dinitro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 3126579 |
| Molecular Formula | C14H17F3N4O5 |
| Molecular Weight | 378.31 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | N-(3-morpholin-4-ylpropyl)-2,6-dinitro-4-(trifluoromethyl)aniline |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)cc([N+](=O)[O-])c1NCCCN1CCOCC1 |
| InChI | InChI=1S/C14H17F3N4O5/c15-14(16,17)10-8-11(20(22)23)13(12(9-10)21(24)25)18-2-1-3-19-4-6-26-7-5-19/h8-9,18H,1-7H2 |
| InChIKey | BOANRLYABXWCRO-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 110.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|