About N-methyl-1,1-dioxo-N-(2-prop-2-enoxyethyl)-1,2-benzothiazol-3-amine
N-methyl-1,1-dioxo-N-(2-prop-2-enoxyethyl)-1,2-benzothiazol-3-amine (PubChem CID 3127022) has the molecular formula C13H16N2O3S
and a molecular weight of 280.35 g/mol. Its IUPAC name is N-methyl-1,1-dioxo-N-(2-prop-2-enoxyethyl)-1,2-benzothiazol-3-amine.
Molecular Properties
| Compound Name | N-methyl-1,1-dioxo-N-(2-prop-2-enoxyethyl)-1,2-benzothiazol-3-amine |
| PubChem CID | 3127022 |
| Molecular Formula | C13H16N2O3S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | N-methyl-1,1-dioxo-N-(2-prop-2-enoxyethyl)-1,2-benzothiazol-3-amine |
| SMILES | C=CCOCCN(C)C1=NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C13H16N2O3S/c1-3-9-18-10-8-15(2)13-11-6-4-5-7-12(11)19(16,17)14-13/h3-7H,1,8-10H2,2H3 |
| InChIKey | LDRPFNXJISSVBM-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-1,1-dioxo-N-(2-prop-2-enoxyethyl)-1,2-benzothiazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1,1-dioxo-N-(2-prop-2-enoxyethyl)-1,2-benzothiazol-3-amine?
The IUPAC name of N-methyl-1,1-dioxo-N-(2-prop-2-enoxyethyl)-1,2-benzothiazol-3-amine (CID 3127022) is N-methyl-1,1-dioxo-N-(2-prop-2-enoxyethyl)-1,2-benzothiazol-3-amine.
What is the SMILES notation for N-methyl-1,1-dioxo-N-(2-prop-2-enoxyethyl)-1,2-benzothiazol-3-amine?
The canonical SMILES for N-methyl-1,1-dioxo-N-(2-prop-2-enoxyethyl)-1,2-benzothiazol-3-amine is C=CCOCCN(C)C1=NS(=O)(=O)c2ccccc21.
What is the InChIKey of N-methyl-1,1-dioxo-N-(2-prop-2-enoxyethyl)-1,2-benzothiazol-3-amine?
The InChIKey is LDRPFNXJISSVBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O3S/c1-3-9-18-10-8-15(2)13-11-6-4-5-7-12(11)19(16,17)14-13/h3-7H,1,8-10H2,2H3.
What are the key properties of N-methyl-1,1-dioxo-N-(2-prop-2-enoxyethyl)-1,2-benzothiazol-3-amine?
N-methyl-1,1-dioxo-N-(2-prop-2-enoxyethyl)-1,2-benzothiazol-3-amine has a molecular weight of 280.35 g/mol, XLogP of 1.27, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1,1-dioxo-N-(2-prop-2-enoxyethyl)-1,2-benzothiazol-3-amine is sourced from PubChem (CID 3127022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).