C15H6Cl7NO2 — CID 3127128
1,7,8,9,10,10-hexachloro-4-(3-chlorophenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 3127128) has the molecular formula C15H6Cl7NO2 and a molecular weight of 480.39 g/mol. Its IUPAC name is 1,7,8,9,10,10-hexachloro-4-(3-chlorophenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | 1,7,8,9,10,10-hexachloro-4-(3-chlorophenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 3127128 |
| Molecular Formula | C15H6Cl7NO2 |
| Molecular Weight | 480.39 g/mol |
| Exact Mass | 476.82 |
| IUPAC Name | 1,7,8,9,10,10-hexachloro-4-(3-chlorophenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C1C2C(C(=O)N1c1cccc(Cl)c1)C1(Cl)C(Cl)=C(Cl)C2(Cl)C1(Cl)Cl |
| InChI | InChI=1S/C15H6Cl7NO2/c16-5-2-1-3-6(4-5)23-11(24)7-8(12(23)25)14(20)10(18)9(17)13(7,19)15(14,21)22/h1-4,7-8H |
| InChIKey | LLRUGDJYLAMRHC-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.39 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|