About 7-[2-[(1-hydroxy-1-phenylpropan-2-yl)-methylamino]ethyl]-1,3-dimethylpurine-2,6-dione
7-[2-[(1-hydroxy-1-phenylpropan-2-yl)-methylamino]ethyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 3127165) has the molecular formula C19H25N5O3
and a molecular weight of 371.44 g/mol. Its IUPAC name is 7-[2-[(1-hydroxy-1-phenylpropan-2-yl)-methylamino]ethyl]-1,3-dimethylpurine-2,6-dione.
Molecular Properties
| Compound Name | 7-[2-[(1-hydroxy-1-phenylpropan-2-yl)-methylamino]ethyl]-1,3-dimethylpurine-2,6-dione |
| PubChem CID | 3127165 |
| Molecular Formula | C19H25N5O3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 7-[2-[(1-hydroxy-1-phenylpropan-2-yl)-methylamino]ethyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | CC(C(O)c1ccccc1)N(C)CCn1cnc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C19H25N5O3/c1-13(16(25)14-8-6-5-7-9-14)21(2)10-11-24-12-20-17-15(24)18(26)23(4)19(27)22(17)3/h5-9,12-13,16,25H,10-11H2,1-4H3 |
| InChIKey | MGXSHFGBKOWNLN-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 85.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 7-[2-[(1-hydroxy-1-phenylpropan-2-yl)-methylamino]ethyl]-1,3-dimethylpurine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[2-[(1-hydroxy-1-phenylpropan-2-yl)-methylamino]ethyl]-1,3-dimethylpurine-2,6-dione?
The IUPAC name of 7-[2-[(1-hydroxy-1-phenylpropan-2-yl)-methylamino]ethyl]-1,3-dimethylpurine-2,6-dione (CID 3127165) is 7-[2-[(1-hydroxy-1-phenylpropan-2-yl)-methylamino]ethyl]-1,3-dimethylpurine-2,6-dione.
What is the SMILES notation for 7-[2-[(1-hydroxy-1-phenylpropan-2-yl)-methylamino]ethyl]-1,3-dimethylpurine-2,6-dione?
The canonical SMILES for 7-[2-[(1-hydroxy-1-phenylpropan-2-yl)-methylamino]ethyl]-1,3-dimethylpurine-2,6-dione is CC(C(O)c1ccccc1)N(C)CCn1cnc2c1c(=O)n(C)c(=O)n2C.
What is the InChIKey of 7-[2-[(1-hydroxy-1-phenylpropan-2-yl)-methylamino]ethyl]-1,3-dimethylpurine-2,6-dione?
The InChIKey is MGXSHFGBKOWNLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25N5O3/c1-13(16(25)14-8-6-5-7-9-14)21(2)10-11-24-12-20-17-15(24)18(26)23(4)19(27)22(17)3/h5-9,12-13,16,25H,10-11H2,1-4H3.
What are the key properties of 7-[2-[(1-hydroxy-1-phenylpropan-2-yl)-methylamino]ethyl]-1,3-dimethylpurine-2,6-dione?
7-[2-[(1-hydroxy-1-phenylpropan-2-yl)-methylamino]ethyl]-1,3-dimethylpurine-2,6-dione has a molecular weight of 371.44 g/mol, XLogP of 0.49, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[2-[(1-hydroxy-1-phenylpropan-2-yl)-methylamino]ethyl]-1,3-dimethylpurine-2,6-dione is sourced from PubChem (CID 3127165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).