C14H13F3N2O — CID 3127171
N-[6-(trifluoromethyl)-2,3,4,9-tetrahydro-1H-carbazol-1-yl]formamide (PubChem CID 3127171) has the molecular formula C14H13F3N2O and a molecular weight of 282.26 g/mol. Its IUPAC name is N-[6-(trifluoromethyl)-2,3,4,9-tetrahydro-1H-carbazol-1-yl]formamide.
| Compound Name | N-[6-(trifluoromethyl)-2,3,4,9-tetrahydro-1H-carbazol-1-yl]formamide |
|---|---|
| PubChem CID | 3127171 |
| Molecular Formula | C14H13F3N2O |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | N-[6-(trifluoromethyl)-2,3,4,9-tetrahydro-1H-carbazol-1-yl]formamide |
| SMILES | O=CNC1CCCc2c1[nH]c1ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C14H13F3N2O/c15-14(16,17)8-4-5-11-10(6-8)9-2-1-3-12(18-7-20)13(9)19-11/h4-7,12,19H,1-3H2,(H,18,20) |
| InChIKey | HFCWDLKJKWRBPQ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|