About N-benzyl-5-morpholin-4-yl-2,4-dinitroaniline
N-benzyl-5-morpholin-4-yl-2,4-dinitroaniline (PubChem CID 3128186) has the molecular formula C17H18N4O5
and a molecular weight of 358.35 g/mol. Its IUPAC name is N-benzyl-5-morpholin-4-yl-2,4-dinitroaniline.
Molecular Properties
| Compound Name | N-benzyl-5-morpholin-4-yl-2,4-dinitroaniline |
| PubChem CID | 3128186 |
| Molecular Formula | C17H18N4O5 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | N-benzyl-5-morpholin-4-yl-2,4-dinitroaniline |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(N2CCOCC2)cc1NCc1ccccc1 |
| InChI | InChI=1S/C17H18N4O5/c22-20(23)15-11-17(21(24)25)16(19-6-8-26-9-7-19)10-14(15)18-12-13-4-2-1-3-5-13/h1-5,10-11,18H,6-9,12H2 |
| InChIKey | IKGDUXGZBQUTJU-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 110.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-5-morpholin-4-yl-2,4-dinitroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-5-morpholin-4-yl-2,4-dinitroaniline?
The IUPAC name of N-benzyl-5-morpholin-4-yl-2,4-dinitroaniline (CID 3128186) is N-benzyl-5-morpholin-4-yl-2,4-dinitroaniline.
What is the SMILES notation for N-benzyl-5-morpholin-4-yl-2,4-dinitroaniline?
The canonical SMILES for N-benzyl-5-morpholin-4-yl-2,4-dinitroaniline is O=[N+]([O-])c1cc([N+](=O)[O-])c(N2CCOCC2)cc1NCc1ccccc1.
What is the InChIKey of N-benzyl-5-morpholin-4-yl-2,4-dinitroaniline?
The InChIKey is IKGDUXGZBQUTJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N4O5/c22-20(23)15-11-17(21(24)25)16(19-6-8-26-9-7-19)10-14(15)18-12-13-4-2-1-3-5-13/h1-5,10-11,18H,6-9,12H2.
What are the key properties of N-benzyl-5-morpholin-4-yl-2,4-dinitroaniline?
N-benzyl-5-morpholin-4-yl-2,4-dinitroaniline has a molecular weight of 358.35 g/mol, XLogP of 2.95, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-5-morpholin-4-yl-2,4-dinitroaniline is sourced from PubChem (CID 3128186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).