About 3-[[4-(2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]amino]phenol
3-[[4-(2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]amino]phenol (PubChem CID 3128426) has the molecular formula C17H14N4OS
and a molecular weight of 322.39 g/mol. Its IUPAC name is 3-[[4-(2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]amino]phenol.
Molecular Properties
| Compound Name | 3-[[4-(2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]amino]phenol |
| PubChem CID | 3128426 |
| Molecular Formula | C17H14N4OS |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 3-[[4-(2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]amino]phenol |
| SMILES | Cc1nc2ccccn2c1-c1csc(Nc2cccc(O)c2)n1 |
| InChI | InChI=1S/C17H14N4OS/c1-11-16(21-8-3-2-7-15(21)18-11)14-10-23-17(20-14)19-12-5-4-6-13(22)9-12/h2-10,22H,1H3,(H,19,20) |
| InChIKey | NBYZOAUVROLNCA-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[[4-(2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]amino]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-(2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]amino]phenol?
The IUPAC name of 3-[[4-(2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]amino]phenol (CID 3128426) is 3-[[4-(2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]amino]phenol.
What is the SMILES notation for 3-[[4-(2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]amino]phenol?
The canonical SMILES for 3-[[4-(2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]amino]phenol is Cc1nc2ccccn2c1-c1csc(Nc2cccc(O)c2)n1.
What is the InChIKey of 3-[[4-(2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]amino]phenol?
The InChIKey is NBYZOAUVROLNCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N4OS/c1-11-16(21-8-3-2-7-15(21)18-11)14-10-23-17(20-14)19-12-5-4-6-13(22)9-12/h2-10,22H,1H3,(H,19,20).
What are the key properties of 3-[[4-(2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]amino]phenol?
3-[[4-(2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]amino]phenol has a molecular weight of 322.39 g/mol, XLogP of 4.22, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-(2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]amino]phenol is sourced from PubChem (CID 3128426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).